CAS 1580086-33-4 is the registry number for 2-Bromo-4,5-difluorobenzohydrazide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-4,5-difluorobenzohydrazide (CAS 1580086-33-4) is a chemical compound with the molecular formula C7H5BrF2N2O and a molecular weight of 251.03 g/mol. IUPAC name: 2-bromo-4,5-difluorobenzohydrazide. InChIKey: HNZKRKKFYBTGLY-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF2N2O |
|---|---|
| Molecular weight | 251.03 g/mol |
| IUPAC name | 2-bromo-4,5-difluorobenzohydrazide |
| InChIKey | HNZKRKKFYBTGLY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)Br)C(=O)NN |
Computed by PubChem (NCBI)