CAS 1823587-94-5 is the registry number for 4-Bromo-2,3-difluorobenzohydrazide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-2,3-difluorobenzohydrazide (CAS 1823587-94-5) is a chemical compound with the molecular formula C7H5BrF2N2O and a molecular weight of 251.03 g/mol. IUPAC name: 4-bromo-2,3-difluorobenzohydrazide. InChIKey: DLHLPQYROZSPQA-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF2N2O |
|---|---|
| Molecular weight | 251.03 g/mol |
| IUPAC name | 4-bromo-2,3-difluorobenzohydrazide |
| InChIKey | DLHLPQYROZSPQA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)NN)F)F)Br |
Computed by PubChem (NCBI)