Products 1580483-91-5
CAS 1580483-91-5 is the registry number for 4-(2-(1H-Pyrazol-1-yl)ethoxy)benzenesulfonyl chloride, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-(2-pyrazol-1-ylethoxy)benzenesulfonyl chloride (CAS 1580483-91-5) is a chemical compound with the molecular formula C11H11ClN2O3S and a molecular weight of 286.74 g/mol. IUPAC name: 4-(2-pyrazol-1-ylethoxy)benzenesulfonyl chloride. InChIKey: GYAIQRHSWYCAML-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O3S |
|---|---|
| Molecular weight | 286.74 g/mol |
| IUPAC name | 4-(2-pyrazol-1-ylethoxy)benzenesulfonyl chloride |
| InChIKey | GYAIQRHSWYCAML-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)CCOC2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)