CAS 76852-02-3 is the registry number for Furosemide Impurity 55. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-4-(furan-2-ylmethylamino)benzenesulfonamide (CAS 76852-02-3) is a chemical compound with the molecular formula C11H11ClN2O3S and a molecular weight of 286.74 g/mol. IUPAC name: 2-chloro-4-(furan-2-ylmethylamino)benzenesulfonamide. InChIKey: KVQSUQONFOYHLJ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O3S |
|---|---|
| Molecular weight | 286.74 g/mol |
| IUPAC name | 2-chloro-4-(furan-2-ylmethylamino)benzenesulfonamide |
| InChIKey | KVQSUQONFOYHLJ-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CNC2=CC(=C(C=C2)S(=O)(=O)N)Cl |
Computed by PubChem (NCBI)