Products 1580484-04-3
CAS 1580484-04-3 is the registry number for Mcl1-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(4-methylnaphthalen-1-yl)-2-[(3-morpholin-4-ylphenyl)sulfonylamino]benzoic acid (CAS 1580484-04-3) is a chemical compound with the molecular formula C28H26N2O5S and a molecular weight of 502.6 g/mol. IUPAC name: 4-(4-methylnaphthalen-1-yl)-2-[(3-morpholin-4-ylphenyl)sulfonylamino]benzoic acid. InChIKey: QFWAEPBEJCIANQ-UHFFFAOYSA-N.
| Molecular formula | C28H26N2O5S |
|---|---|
| Molecular weight | 502.6 g/mol |
| IUPAC name | 4-(4-methylnaphthalen-1-yl)-2-[(3-morpholin-4-ylphenyl)sulfonylamino]benzoic acid |
| InChIKey | QFWAEPBEJCIANQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C2=CC=CC=C12)C3=CC(=C(C=C3)C(=O)O)NS(=O)(=O)C4=CC=CC(=C4)N5CCOCC5 |
Computed by PubChem (NCBI)
Synonyms:
Mcl1-IN-4, orb1709169