CAS 158094-17-8 is the registry number for 2-Chloro-n-(2,4-dimethoxyphenyl)nicotinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-chloro-N-(2,4-dimethoxyphenyl)pyridine-3-carboxamide (CAS 158094-17-8) is a chemical compound with the molecular formula C14H13ClN2O3 and a molecular weight of 292.72 g/mol. IUPAC name: 2-chloro-N-(2,4-dimethoxyphenyl)pyridine-3-carboxamide. InChIKey: FQALSYKXWIIZBM-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O3 |
|---|---|
| Molecular weight | 292.72 g/mol |
| IUPAC name | 2-chloro-N-(2,4-dimethoxyphenyl)pyridine-3-carboxamide |
| InChIKey | FQALSYKXWIIZBM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)NC(=O)C2=C(N=CC=C2)Cl)OC |
Computed by PubChem (NCBI)