CAS 2782812-51-3 is the registry number for Methyl 2'-chloro-5'-methoxy-6-methyl-[4,4'-bipyridine]-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-(2-chloro-5-methoxy-4-pyridinyl)-6-methylpyridine-3-carboxylate (CAS 2782812-51-3) is a chemical compound with the molecular formula C14H13ClN2O3 and a molecular weight of 292.72 g/mol. IUPAC name: methyl 4-(2-chloro-5-methoxy-4-pyridinyl)-6-methylpyridine-3-carboxylate. InChIKey: WGRUJRARUWBPAE-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O3 |
|---|---|
| Molecular weight | 292.72 g/mol |
| IUPAC name | methyl 4-(2-chloro-5-methoxy-4-pyridinyl)-6-methylpyridine-3-carboxylate |
| InChIKey | WGRUJRARUWBPAE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=N1)C(=O)OC)C2=CC(=NC=C2OC)Cl |
Computed by PubChem (NCBI)