CAS 1581704-70-2 is the registry number for Chloromethyl 1-([(tert-butoxy)carbonyl]amino)cyclopropane-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Chloromethyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate (CAS 1581704-70-2) is a chemical compound with the molecular formula C10H16ClNO4 and a molecular weight of 249.69 g/mol. IUPAC name: chloromethyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate. InChIKey: XSIYMIOJVJCHJA-UHFFFAOYSA-N.
| Molecular formula | C10H16ClNO4 |
|---|---|
| Molecular weight | 249.69 g/mol |
| IUPAC name | chloromethyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate |
| InChIKey | XSIYMIOJVJCHJA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CC1)C(=O)OCCl |
Computed by PubChem (NCBI)