Products 2137507-32-3

CAS 2137507-32-3 is the registry number for 1-tert-Butyl 2-chloromethyl azetidine-1,2-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 2-O-(chloromethyl) azetidine-1,2-dicarboxylate (CAS 2137507-32-3) is a chemical compound with the molecular formula C10H16ClNO4 and a molecular weight of 249.69 g/mol. IUPAC name: 1-O-tert-butyl 2-O-(chloromethyl) azetidine-1,2-dicarboxylate. InChIKey: JXLPGUPPKKLTLH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16ClNO4
Molecular weight249.69 g/mol
IUPAC name1-O-tert-butyl 2-O-(chloromethyl) azetidine-1,2-dicarboxylate
InChIKeyJXLPGUPPKKLTLH-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC1C(=O)OCCl

Computed by PubChem (NCBI)