CAS 1581771-55-2 appears in our catalog under these names: 2-(2-Methoxyethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-(2-Methoxyethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 2-(2-Methoxyethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 2-(2-Methoxyethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%. Offered by: Biosynth, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 5g, 1g, 10g, 250mg.
2-(2-methoxyethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1581771-55-2) is a chemical compound with the molecular formula C9H19BO3 and a molecular weight of 186.06 g/mol. IUPAC name: 2-(2-methoxyethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: WRXQLGJBDGCOQA-UHFFFAOYSA-N.
| Molecular formula | C9H19BO3 |
|---|---|
| Molecular weight | 186.06 g/mol |
| IUPAC name | 2-(2-methoxyethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | WRXQLGJBDGCOQA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCOC |
Computed by PubChem (NCBI)