CAS 61676-62-8 appears in our catalog under these names: 2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2–Isopropoxy–4,4,5,5–tetramethyl–1,3,2–dioxaborolane, 2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 94% , 2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >98.0%(GC)(T), 2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 97%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 10g, 25g, 5g, 500g, 0,25kg, 0,5kg, 100g, 1kg.
4,4,5,5-tetramethyl-2-propan-2-yloxy-1,3,2-dioxaborolane (CAS 61676-62-8) is a chemical compound with the molecular formula C9H19BO3 and a molecular weight of 186.06 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-propan-2-yloxy-1,3,2-dioxaborolane. InChIKey: MRWWWZLJWNIEEJ-UHFFFAOYSA-N.
| Molecular formula | C9H19BO3 |
|---|---|
| Molecular weight | 186.06 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-propan-2-yloxy-1,3,2-dioxaborolane |
| InChIKey | MRWWWZLJWNIEEJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)OC(C)C |
Computed by PubChem (NCBI)