CAS 15827-70-0 is the registry number for Pyridinium, 1,2,4-trimethyl-, iodide, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
1,2,4-trimethylpyridin-1-ium iodide (CAS 15827-70-0) is a chemical compound with the molecular formula C8H12IN and a molecular weight of 249.09 g/mol. IUPAC name: 1,2,4-trimethylpyridin-1-ium iodide. InChIKey: QYDJCYFTRFULIB-UHFFFAOYSA-M.
| Molecular formula | C8H12IN |
|---|---|
| Molecular weight | 249.09 g/mol |
| IUPAC name | 1,2,4-trimethylpyridin-1-ium iodide |
| InChIKey | QYDJCYFTRFULIB-UHFFFAOYSA-M |
| SMILES | CC1=CC(=[N+](C=C1)C)C.[I-] |
Computed by PubChem (NCBI)