Products 19760-15-7

CAS 19760-15-7 is the registry number for Pyridinium, 1-ethyl-2-methyl-, iodide (1:1), 98%(NMR), 98%(NMR). Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

1-ethyl-2-methylpyridin-1-ium iodide (CAS 19760-15-7) is a chemical compound with the molecular formula C8H12IN and a molecular weight of 249.09 g/mol. IUPAC name: 1-ethyl-2-methylpyridin-1-ium iodide. InChIKey: NMYWANRCPFUKKO-UHFFFAOYSA-M.

Identity
Molecular formulaC8H12IN
Molecular weight249.09 g/mol
IUPAC name1-ethyl-2-methylpyridin-1-ium iodide
InChIKeyNMYWANRCPFUKKO-UHFFFAOYSA-M
SMILESCC[N+]1=CC=CC=C1C.[I-]

Computed by PubChem (NCBI)