Products 1582770-05-5

CAS 1582770-05-5 is the registry number for 3-(4-Bromophenoxy)propyl acetate, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

3-(4-bromophenoxy)propyl acetate (CAS 1582770-05-5) is a chemical compound with the molecular formula C11H13BrO3 and a molecular weight of 273.12 g/mol. IUPAC name: 3-(4-bromophenoxy)propyl acetate. InChIKey: DBEXGNOIGKXIDC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13BrO3
Molecular weight273.12 g/mol
IUPAC name3-(4-bromophenoxy)propyl acetate
InChIKeyDBEXGNOIGKXIDC-UHFFFAOYSA-N
SMILESCC(=O)OCCCOC1=CC=C(C=C1)Br

Computed by PubChem (NCBI)