Products 1583238-33-8

CAS 1583238-33-8 is the registry number for Ropivacaine Impurity 8 HCl. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

N-(2,4-dimethylphenyl)piperidine-2-carboxamide (CAS 1583238-33-8) is a chemical compound with the molecular formula C14H20N2O and a molecular weight of 232.32 g/mol. IUPAC name: N-(2,4-dimethylphenyl)piperidine-2-carboxamide. InChIKey: MMGNWABXVJFAIQ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20N2O
Molecular weight232.32 g/mol
IUPAC nameN-(2,4-dimethylphenyl)piperidine-2-carboxamide
InChIKeyMMGNWABXVJFAIQ-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)NC(=O)C2CCCCN2)C

Computed by PubChem (NCBI)