CAS 1583309-36-7 is the registry number for (R)-4,4,4-Trifluoro-3-(4-fluorophenyl)butanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-4,4,4-trifluoro-3-(4-fluorophenyl)butanoic acid (CAS 1583309-36-7) is a chemical compound with the molecular formula C10H8F4O2 and a molecular weight of 236.16 g/mol. IUPAC name: (3R)-4,4,4-trifluoro-3-(4-fluorophenyl)butanoic acid. InChIKey: DWYJYVHKCCWFME-MRVPVSSYSA-N.
| Molecular formula | C10H8F4O2 |
|---|---|
| Molecular weight | 236.16 g/mol |
| IUPAC name | (3R)-4,4,4-trifluoro-3-(4-fluorophenyl)butanoic acid |
| InChIKey | DWYJYVHKCCWFME-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CC(=O)O)C(F)(F)F)F |
Computed by PubChem (NCBI)