Products 158411-82-6
CAS 158411-82-6 appears in our catalog under these names: Formyl DL-Penicillamine, Tazobactam Impurity B, 2-Formamido-3-mercapto-3-methylbutanoic acid, 95%, N-Formyl-3-mercaptovaline, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg, 500mg.
(2R)-2-formamido-3-methyl-3-sulfanylbutanoic acid (CAS 158411-82-6) is a chemical compound with the molecular formula C6H11NO3S and a molecular weight of 177.22 g/mol. IUPAC name: (2R)-2-formamido-3-methyl-3-sulfanylbutanoic acid. InChIKey: ANCLDHSEMKEXLS-SCSAIBSYSA-N.
| Molecular formula | C6H11NO3S |
|---|---|
| Molecular weight | 177.22 g/mol |
| IUPAC name | (2R)-2-formamido-3-methyl-3-sulfanylbutanoic acid |
| InChIKey | ANCLDHSEMKEXLS-SCSAIBSYSA-N |
| SMILES | CC(C)([C@@H](C(=O)O)NC=O)S |
Computed by PubChem (NCBI)