CAS 884311-05-1 is the registry number for Formyl L-Penicillamine. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-formamido-3-methyl-3-sulfanylbutanoic acid (CAS 884311-05-1) is a chemical compound with the molecular formula C6H11NO3S and a molecular weight of 177.22 g/mol. IUPAC name: (2R)-2-formamido-3-methyl-3-sulfanylbutanoic acid. InChIKey: ANCLDHSEMKEXLS-SCSAIBSYSA-N.
| Molecular formula | C6H11NO3S |
|---|---|
| Molecular weight | 177.22 g/mol |
| IUPAC name | (2R)-2-formamido-3-methyl-3-sulfanylbutanoic acid |
| InChIKey | ANCLDHSEMKEXLS-SCSAIBSYSA-N |
| SMILES | CC(C)([C@@H](C(=O)O)NC=O)S |
Computed by PubChem (NCBI)