CAS 158439-31-7 is the registry number for Dimethyl3–(chlorosulfonyl)thiophene–2,5–dicarboxylate. Offered by: GLPBio. Available pack sizes: 1g, 5g.
Methyl 5-chloro-3-chlorosulfonylthiophene-2-carboxylate (CAS 158439-31-7) is a chemical compound with the molecular formula C6H4Cl2O4S2 and a molecular weight of 275.1 g/mol. IUPAC name: methyl 5-chloro-3-chlorosulfonylthiophene-2-carboxylate. InChIKey: GDKPWFMFFKPATJ-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2O4S2 |
|---|---|
| Molecular weight | 275.1 g/mol |
| IUPAC name | methyl 5-chloro-3-chlorosulfonylthiophene-2-carboxylate |
| InChIKey | GDKPWFMFFKPATJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(S1)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)