CAS 6461-76-3 appears in our catalog under these names: 1,2-Benzenedisulfonyl dichloride, 95%, 1,2-Benzenedisulfonyl Dichloride, 98%, 1,2-Benzenedisulfonyl chloride , 1,2-Benzenedisulfonyl Dichloride, 1,2-Benzenedisulfonyl Dichloride, >98.0%(T). Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 1g, 5g, 25g, 250mg.
Benzene-1,2-disulfonyl chloride (CAS 6461-76-3) is a chemical compound with the molecular formula C6H4Cl2O4S2 and a molecular weight of 275.1 g/mol. IUPAC name: benzene-1,2-disulfonyl chloride. InChIKey: YBGQXNZTVFEKEN-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2O4S2 |
|---|---|
| Molecular weight | 275.1 g/mol |
| IUPAC name | benzene-1,2-disulfonyl chloride |
| InChIKey | YBGQXNZTVFEKEN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)S(=O)(=O)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)