Products 158461-00-8
CAS 158461-00-8 appears in our catalog under these names: Ethyl 2-amino-5-tert-butylthiophene-3-carboxylate, 95%, Ethyl 2-amino-5-tert-butylthiophene-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Ethyl 2-amino-5-tert-butylthiophene-3-carboxylate (CAS 158461-00-8) is a chemical compound with the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. IUPAC name: ethyl 2-amino-5-tert-butylthiophene-3-carboxylate. InChIKey: VULBATZCZZZNSX-UHFFFAOYSA-N.
| Molecular formula | C11H17NO2S |
|---|---|
| Molecular weight | 227.33 g/mol |
| IUPAC name | ethyl 2-amino-5-tert-butylthiophene-3-carboxylate |
| InChIKey | VULBATZCZZZNSX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=C1)C(C)(C)C)N |
Computed by PubChem (NCBI)