CAS 15850-81-4 appears in our catalog under these names: 6–Isopropoxybenzo(d)thiazol–2–amine, 6-Isopropoxybenzo[d]thiazol-2-amine 97%, 6-Isopropoxybenzo[d]thiazol-2-amine, 97%, 97%, 6-Isopropoxy-1,3-benzothiazol-2-amine, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
6-propan-2-yloxy-1,3-benzothiazol-2-amine (CAS 15850-81-4) is a chemical compound with the molecular formula C10H12N2OS and a molecular weight of 208.28 g/mol. IUPAC name: 6-propan-2-yloxy-1,3-benzothiazol-2-amine. InChIKey: WFGYJPDSKYTVNR-UHFFFAOYSA-N.
| Molecular formula | C10H12N2OS |
|---|---|
| Molecular weight | 208.28 g/mol |
| IUPAC name | 6-propan-2-yloxy-1,3-benzothiazol-2-amine |
| InChIKey | WFGYJPDSKYTVNR-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC2=C(C=C1)N=C(S2)N |
Computed by PubChem (NCBI)