Products 158579-73-8

CAS 158579-73-8 is the registry number for 2-Chloro-4-(methylsulfonamido)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-chloro-4-(methanesulfonamido)benzoic acid (CAS 158579-73-8) is a chemical compound with the molecular formula C8H8ClNO4S and a molecular weight of 249.67 g/mol. IUPAC name: 2-chloro-4-(methanesulfonamido)benzoic acid. InChIKey: JJPZWTSCHWHTEH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClNO4S
Molecular weight249.67 g/mol
IUPAC name2-chloro-4-(methanesulfonamido)benzoic acid
InChIKeyJJPZWTSCHWHTEH-UHFFFAOYSA-N
SMILESCS(=O)(=O)NC1=CC(=C(C=C1)C(=O)O)Cl

Computed by PubChem (NCBI)