Products 62564-49-2
CAS 62564-49-2 is the registry number for 2,5-Dimethyl-3-nitrobenzene-1-sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2,5-dimethyl-3-nitrobenzenesulfonyl chloride (CAS 62564-49-2) is a chemical compound with the molecular formula C8H8ClNO4S and a molecular weight of 249.67 g/mol. IUPAC name: 2,5-dimethyl-3-nitrobenzenesulfonyl chloride. InChIKey: UPYQIZCIGYABBD-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO4S |
|---|---|
| Molecular weight | 249.67 g/mol |
| IUPAC name | 2,5-dimethyl-3-nitrobenzenesulfonyl chloride |
| InChIKey | UPYQIZCIGYABBD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)S(=O)(=O)Cl)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)