Products 1585941-14-5
CAS 1585941-14-5 is the registry number for Perfluorohexanesulfonic acid 18O2 sodium 50 µg/mL in Methanol:Water. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.
Sodium 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-(18O2)sulfonate (CAS 1585941-14-5) is a chemical compound with the molecular formula C6F13NaO3S and a molecular weight of 426.10 g/mol. IUPAC name: sodium 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-(18O2)sulfonate. InChIKey: WXNIEINRHBIHRE-NVEWVSFYSA-M.
| Molecular formula | C6F13NaO3S |
|---|---|
| Molecular weight | 426.10 g/mol |
| IUPAC name | sodium 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-(18O2)sulfonate |
| InChIKey | WXNIEINRHBIHRE-NVEWVSFYSA-M |
| SMILES | C(C(C(C(F)(F)S(=[18O])(=[18O])[O-])(F)F)(F)F)(C(C(F)(F)F)(F)F)(F)F.[Na+] |
Computed by PubChem (NCBI)