CAS 82382-12-5 appears in our catalog under these names: Sodium Perfluorohexanesulfonate (50 ug/mL in Methanol), Perfluorohexanesulfonic acid sodium, Sodium Perfluorohexanesulfonate, >95% (HPLC). Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 10x1ml, 10mg, 100mg, 250mg, 50mg.
Sodium 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate (CAS 82382-12-5) is a chemical compound with the molecular formula C6F13NaO3S and a molecular weight of 422.10 g/mol. IUPAC name: sodium 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate. InChIKey: WXNIEINRHBIHRE-UHFFFAOYSA-M.
| Molecular formula | C6F13NaO3S |
|---|---|
| Molecular weight | 422.10 g/mol |
| IUPAC name | sodium 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate |
| InChIKey | WXNIEINRHBIHRE-UHFFFAOYSA-M |
| SMILES | C(C(C(C(F)(F)S(=O)(=O)[O-])(F)F)(F)F)(C(C(F)(F)F)(F)F)(F)F.[Na+] |
Computed by PubChem (NCBI)