CAS 1585960-54-8 appears in our catalog under these names: (Z)-4-(Dimethylamino)-N'-hydroxybenzimidamide, 97%, (E)-4-(Dimethylamino)-N'-hydroxybenzene-1-carboximidamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-(dimethylamino)-N'-hydroxybenzenecarboximidamide (CAS 1585960-54-8) is a chemical compound with the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. IUPAC name: 4-(dimethylamino)-N'-hydroxybenzenecarboximidamide. InChIKey: NLVACMKNLOCQRQ-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 4-(dimethylamino)-N'-hydroxybenzenecarboximidamide |
| InChIKey | NLVACMKNLOCQRQ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)/C(=N/O)/N |
Computed by PubChem (NCBI)