CAS 158636-97-6 appears in our catalog under these names: Timolol EP Impurity H, Timolol Impurity 8(Timolol EP Impurity H), 2-(3-(tert-Butylamino)-2-hydroxypropyl)-4-morpholino-1,2,5-thiadiazol-3(2H)-one (>90%), 2-(3-(tert-Butylamino)-2-hydroxypropyl)-4-morpholino-1,2,5-thiadiazol-3(2H)-one. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 0,5mg, 5mg.
2-[3-(tert-butylamino)-2-hydroxypropyl]-4-morpholin-4-yl-1,2,5-thiadiazol-3-one (CAS 158636-97-6) is a chemical compound with the molecular formula C13H24N4O3S and a molecular weight of 316.42 g/mol. IUPAC name: 2-[3-(tert-butylamino)-2-hydroxypropyl]-4-morpholin-4-yl-1,2,5-thiadiazol-3-one. InChIKey: NRTPOFNBMLVPDO-UHFFFAOYSA-N.
| Molecular formula | C13H24N4O3S |
|---|---|
| Molecular weight | 316.42 g/mol |
| IUPAC name | 2-[3-(tert-butylamino)-2-hydroxypropyl]-4-morpholin-4-yl-1,2,5-thiadiazol-3-one |
| InChIKey | NRTPOFNBMLVPDO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(CN1C(=O)C(=NS1)N2CCOCC2)O |
Computed by PubChem (NCBI)