Products 59697-06-2
CAS 59697-06-2 appears in our catalog under these names: Timolol impurity B, 10 mg, Timolol EP Impurity B, Isotimolol（Timolol EP Impurity B）, rac-Isotimolol, Timolol Related Compound B 97%. Offered by: Roth, Chemat Brand, TRC, Ambeed, Chemat. Available pack sizes: 10mg, on request, 100mg, 5g, 50mg, 250mg, 1g, 5mg.
3-(tert-butylamino)-2-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]propan-1-ol (CAS 59697-06-2) is a chemical compound with the molecular formula C13H24N4O3S and a molecular weight of 316.42 g/mol. IUPAC name: 3-(tert-butylamino)-2-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]propan-1-ol. InChIKey: MAMSPDKEMJALRZ-UHFFFAOYSA-N.
| Molecular formula | C13H24N4O3S |
|---|---|
| Molecular weight | 316.42 g/mol |
| IUPAC name | 3-(tert-butylamino)-2-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]propan-1-ol |
| InChIKey | MAMSPDKEMJALRZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(CO)OC1=NSN=C1N2CCOCC2 |
Computed by PubChem (NCBI)
Synonyms:
Isotimolol, Timolol maleate specified impurity B [EP], TIMOLOL MALEATE IMPURITY B [EP IMPURITY], TIMOLOL MALEATE IMPURITY B (EP IMPURITY), Timolol maleate specified impurity B, rac-Isotimolol, 3-(tert-butylamino)-2-((4-morpholino-1,2,5-thiadiazol-3-yl)oxy)propan-1-ol, Timolol Maleate EP Impurity B, 3-(tert-butylamino)-2-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]propan-1-ol, Timolol EP Impurity B