CAS 158666-42-3 is the registry number for 6,6′–bis(bromomethyl)–2,2′–bipyridine–4–carboxylic acid methyl ester. Offered by: GLPBio. Available pack sizes: 200mg.
Methyl 2-(bromomethyl)-6-[6-(bromomethyl)-2-pyridinyl]pyridine-4-carboxylate (CAS 158666-42-3) is a chemical compound with the molecular formula C14H12Br2N2O2 and a molecular weight of 400.06 g/mol. IUPAC name: methyl 2-(bromomethyl)-6-[6-(bromomethyl)-2-pyridinyl]pyridine-4-carboxylate. InChIKey: MUWANRNBIFGYDJ-UHFFFAOYSA-N.
| Molecular formula | C14H12Br2N2O2 |
|---|---|
| Molecular weight | 400.06 g/mol |
| IUPAC name | methyl 2-(bromomethyl)-6-[6-(bromomethyl)-2-pyridinyl]pyridine-4-carboxylate |
| InChIKey | MUWANRNBIFGYDJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC(=C1)C2=CC=CC(=N2)CBr)CBr |
Computed by PubChem (NCBI)