CAS 2987179-64-4 is the registry number for (E)-1,2-Bis(4-bromo-2-methoxyphenyl)diazene, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Bis(4-bromo-2-methoxyphenyl)diazene (CAS 2987179-64-4) is a chemical compound with the molecular formula C14H12Br2N2O2 and a molecular weight of 400.06 g/mol. IUPAC name: bis(4-bromo-2-methoxyphenyl)diazene. InChIKey: XYACWZCWZLEDDH-UHFFFAOYSA-N.
| Molecular formula | C14H12Br2N2O2 |
|---|---|
| Molecular weight | 400.06 g/mol |
| IUPAC name | bis(4-bromo-2-methoxyphenyl)diazene |
| InChIKey | XYACWZCWZLEDDH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Br)N=NC2=C(C=C(C=C2)Br)OC |
Computed by PubChem (NCBI)