Products 1586791-66-3
CAS 1586791-66-3 is the registry number for tert-butyl (1R,2R)-2-methylcyclohexylcarbamate, 95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl N-[(1R,2R)-2-methylcyclohexyl]carbamate (CAS 1586791-66-3) is a chemical compound with the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. IUPAC name: tert-butyl N-[(1R,2R)-2-methylcyclohexyl]carbamate. InChIKey: GOANFPGAELOCAZ-NXEZZACHSA-N.
| Molecular formula | C12H23NO2 |
|---|---|
| Molecular weight | 213.32 g/mol |
| IUPAC name | tert-butyl N-[(1R,2R)-2-methylcyclohexyl]carbamate |
| InChIKey | GOANFPGAELOCAZ-NXEZZACHSA-N |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)