Products 158680-31-0
CAS 158680-31-0 is the registry number for (2R,5S)-1-tert-butyl 2-ethyl 5-phenylpyrrolidine-1,2-dicarboxylate, 95%. Offered by: Chemat. Available pack sizes: 1g.
1-O-tert-butyl 2-O-ethyl (2R,5S)-5-phenylpyrrolidine-1,2-dicarboxylate (CAS 158680-31-0) is a chemical compound with the molecular formula C18H25NO4 and a molecular weight of 319.4 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl (2R,5S)-5-phenylpyrrolidine-1,2-dicarboxylate. InChIKey: BNNNTWAYBUJGPI-LSDHHAIUSA-N.
| Molecular formula | C18H25NO4 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl (2R,5S)-5-phenylpyrrolidine-1,2-dicarboxylate |
| InChIKey | BNNNTWAYBUJGPI-LSDHHAIUSA-N |
| SMILES | CCOC(=O)[C@H]1CC[C@H](N1C(=O)OC(C)(C)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)