CAS 15873-51-5 appears in our catalog under these names: 4-Nitroaniline hydrochloride, 95%, 4–Nitroaniline Hydrochloride, 4-Nitroaniline Hydrochloride, >99.0%(HPLC)(T), 4-Nitroaniline Hydrochloride, 4-Nitroaniline hydrochloride, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Chemat. Available pack sizes: 5g, 25g, 1g, 100g, 10g, 2,5g, 0,25g.
4-nitroaniline;hydrochloride (CAS 15873-51-5) is a chemical compound with the molecular formula C6H7ClN2O2 and a molecular weight of 174.58 g/mol. IUPAC name: 4-nitroaniline;hydrochloride. InChIKey: LNJUVOPKIUQOQK-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O2 |
|---|---|
| Molecular weight | 174.58 g/mol |
| IUPAC name | 4-nitroaniline;hydrochloride |
| InChIKey | LNJUVOPKIUQOQK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)