CAS 15873-52-6 appears in our catalog under these names: 2-Nitroaniline hydrochloride, 98%, 2-Nitroaniline hydrochloride 95+%, 2-Nitroaniline Hydrochloride, 95+%, 95+%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g, 10g, 500g, 1000g, 1kg.
2-nitroaniline;hydrochloride (CAS 15873-52-6) is a chemical compound with the molecular formula C6H7ClN2O2 and a molecular weight of 174.58 g/mol. IUPAC name: 2-nitroaniline;hydrochloride. InChIKey: RVOCTLMBKVTNFR-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O2 |
|---|---|
| Molecular weight | 174.58 g/mol |
| IUPAC name | 2-nitroaniline;hydrochloride |
| InChIKey | RVOCTLMBKVTNFR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)