Products 158749-76-9

CAS 158749-76-9 is the registry number for (S)-(+)-Hydroxy Chloroquine Diphosphate. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 25mg, 10mg, 50mg.

Structural formula: {0} (CAS {1})

2-[[(4S)-4-[(7-chloroquinolin-4-yl)amino]pentyl]-ethylamino]ethanol (CAS 158749-76-9) is a chemical compound with the molecular formula C18H26ClN3O and a molecular weight of 335.9 g/mol. IUPAC name: 2-[[(4S)-4-[(7-chloroquinolin-4-yl)amino]pentyl]-ethylamino]ethanol. InChIKey: XXSMGPRMXLTPCZ-AWEZNQCLSA-N.

Identity
Molecular formulaC18H26ClN3O
Molecular weight335.9 g/mol
IUPAC name2-[[(4S)-4-[(7-chloroquinolin-4-yl)amino]pentyl]-ethylamino]ethanol
InChIKeyXXSMGPRMXLTPCZ-AWEZNQCLSA-N
SMILESCCN(CCC[C@H](C)NC1=C2C=CC(=CC2=NC=C1)Cl)CCO

Computed by PubChem (NCBI)