Products 68121-48-2

CAS 68121-48-2 is the registry number for Chloroquine N-Oxide. Offered by: TRC, Biosynth. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

4-[(7-chloroquinolin-4-yl)amino]-N,N-diethylpentan-1-amine oxide (CAS 68121-48-2) is a chemical compound with the molecular formula C18H26ClN3O and a molecular weight of 335.9 g/mol. IUPAC name: 4-[(7-chloroquinolin-4-yl)amino]-N,N-diethylpentan-1-amine oxide. InChIKey: HPVLZIVCPLRCAH-UHFFFAOYSA-N.

Identity
Molecular formulaC18H26ClN3O
Molecular weight335.9 g/mol
IUPAC name4-[(7-chloroquinolin-4-yl)amino]-N,N-diethylpentan-1-amine oxide
InChIKeyHPVLZIVCPLRCAH-UHFFFAOYSA-N
SMILESCC[N+](CC)(CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)[O-]

Computed by PubChem (NCBI)