CAS 68121-48-2 is the registry number for Chloroquine N-Oxide. Offered by: TRC, Biosynth. Available pack sizes: 100mg.
4-[(7-chloroquinolin-4-yl)amino]-N,N-diethylpentan-1-amine oxide (CAS 68121-48-2) is a chemical compound with the molecular formula C18H26ClN3O and a molecular weight of 335.9 g/mol. IUPAC name: 4-[(7-chloroquinolin-4-yl)amino]-N,N-diethylpentan-1-amine oxide. InChIKey: HPVLZIVCPLRCAH-UHFFFAOYSA-N.
| Molecular formula | C18H26ClN3O |
|---|---|
| Molecular weight | 335.9 g/mol |
| IUPAC name | 4-[(7-chloroquinolin-4-yl)amino]-N,N-diethylpentan-1-amine oxide |
| InChIKey | HPVLZIVCPLRCAH-UHFFFAOYSA-N |
| SMILES | CC[N+](CC)(CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)[O-] |
Computed by PubChem (NCBI)