CAS 1588507-64-5 is the registry number for (3aS,6aS)-tert-Butyl 5-benzylhexahydropyrrolo[3,4-c]pyrrole-2(1H)-carboxylate, 97%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
Tert-butyl (3aS,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (CAS 1588507-64-5) is a chemical compound with the molecular formula C18H26N2O2 and a molecular weight of 302.4 g/mol. IUPAC name: tert-butyl (3aS,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate. InChIKey: WUEVXPVJRUPJLC-HOTGVXAUSA-N.
| Molecular formula | C18H26N2O2 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | tert-butyl (3aS,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| InChIKey | WUEVXPVJRUPJLC-HOTGVXAUSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CN(C[C@H]2C1)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)