CAS 1588508-83-1 is the registry number for 4-Cyano-2-(propan-2-yl)phenyl trifluoromethanesulfonate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(4-cyano-2-propan-2-ylphenyl) trifluoromethanesulfonate (CAS 1588508-83-1) is a chemical compound with the molecular formula C11H10F3NO3S and a molecular weight of 293.26 g/mol. IUPAC name: (4-cyano-2-propan-2-ylphenyl) trifluoromethanesulfonate. InChIKey: LQNAJVQZGQNCAZ-UHFFFAOYSA-N.
| Molecular formula | C11H10F3NO3S |
|---|---|
| Molecular weight | 293.26 g/mol |
| IUPAC name | (4-cyano-2-propan-2-ylphenyl) trifluoromethanesulfonate |
| InChIKey | LQNAJVQZGQNCAZ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=CC(=C1)C#N)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)