CAS 338421-05-9 is the registry number for 2-({2-Oxo-2-[3-(trifluoromethyl)anilino]ethyl}sulfanyl)acetic acid. Offered by: Fluorochem. Available pack sizes: 250mg, 500mg, 1g.
2-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]sulfanylacetic acid (CAS 338421-05-9) is a chemical compound with the molecular formula C11H10F3NO3S and a molecular weight of 293.26 g/mol. IUPAC name: 2-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]sulfanylacetic acid. InChIKey: IJHVISSLZSLQOZ-UHFFFAOYSA-N.
| Molecular formula | C11H10F3NO3S |
|---|---|
| Molecular weight | 293.26 g/mol |
| IUPAC name | 2-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]sulfanylacetic acid |
| InChIKey | IJHVISSLZSLQOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)CSCC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)