CAS 158878-54-7 appears in our catalog under these names: 5-Phenyl-1,2,3,6-tetrahydropyridine hydrochloride, 95%, 5-Phenyl-1,2,3,6-tetrahydropyridine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-phenyl-1,2,3,6-tetrahydropyridine;hydrochloride (CAS 158878-54-7) is a chemical compound with the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. IUPAC name: 5-phenyl-1,2,3,6-tetrahydropyridine;hydrochloride. InChIKey: AERNNJNTNZDJDC-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | 5-phenyl-1,2,3,6-tetrahydropyridine;hydrochloride |
| InChIKey | AERNNJNTNZDJDC-UHFFFAOYSA-N |
| SMILES | C1CNCC(=C1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)