CAS 158918-48-0 is the registry number for N–(3–Bromobenzylidene)–4–methylbenzenesulfonohydrazide. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
N-[(E)-(3-bromophenyl)methylideneamino]-4-methylbenzenesulfonamide (CAS 158918-48-0) is a chemical compound with the molecular formula C14H13BrN2O2S and a molecular weight of 353.24 g/mol. IUPAC name: N-[(E)-(3-bromophenyl)methylideneamino]-4-methylbenzenesulfonamide. InChIKey: ZXUZXCODFXAQCM-MHWRWJLKSA-N.
| Molecular formula | C14H13BrN2O2S |
|---|---|
| Molecular weight | 353.24 g/mol |
| IUPAC name | N-[(E)-(3-bromophenyl)methylideneamino]-4-methylbenzenesulfonamide |
| InChIKey | ZXUZXCODFXAQCM-MHWRWJLKSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)