CAS 158930-17-7 appears in our catalog under these names: Frovatriptan Succinate Monohydrate, Frovatriptan succinate hydrate/ 99.95% (existing batch purity), Frovatriptan (succinate hydrate), Frovatriptan succinate hydrate, (R)-3-(Methylamino)-2,3,4,9-tetrahydro-1H-carbazole-6-carboxamide succinate hydrate, 99%, 99%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 0,5mg, 2,5mg, 5mg, 2mg, 10mg, 25mg, 50mg, 100mg.
Butanedioic acid;(6R)-6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide;hydrate (CAS 158930-17-7) is a chemical compound with the molecular formula C18H25N3O6 and a molecular weight of 379.4 g/mol. IUPAC name: butanedioic acid;(6R)-6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide;hydrate. InChIKey: CUETXFMONOSVJA-KLQYNRQASA-N.
| Molecular formula | C18H25N3O6 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | butanedioic acid;(6R)-6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide;hydrate |
| InChIKey | CUETXFMONOSVJA-KLQYNRQASA-N |
| SMILES | CN[C@@H]1CCC2=C(C1)C3=C(N2)C=CC(=C3)C(=O)N.C(CC(=O)O)C(=O)O.O |
Computed by PubChem (NCBI)