CAS 56186-50-6 appears in our catalog under these names: FA–Gly–Leu–Ala–OH, FA-Gly-Leu-Ala-OH, FA-Gly-Leu-Ala-OH TFA, min. 95 %, 25 mg, FA-Gly-Leu-Ala-OH TFA, min. 95 %, 50 mg, FA-Gly-Leu-Ala-OH TFA, min. 95 %, 100 mg. Offered by: GLPBio, Creative Peptides, Biosynth, Roth. Available pack sizes: 50mg, on request, 250mg, 1000mg, 500mg, 25mg, 100mg.
(2S)-2-[[(2S)-2-[[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]acetyl]amino]-4-methylpentanoyl]amino]propanoic acid (CAS 56186-50-6) is a chemical compound with the molecular formula C18H25N3O6 and a molecular weight of 379.4 g/mol. IUPAC name: (2S)-2-[[(2S)-2-[[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]acetyl]amino]-4-methylpentanoyl]amino]propanoic acid. InChIKey: LZTLWPXVLKHTRU-UTTOWCGFSA-N.
| Molecular formula | C18H25N3O6 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-[[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]acetyl]amino]-4-methylpentanoyl]amino]propanoic acid |
| InChIKey | LZTLWPXVLKHTRU-UTTOWCGFSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)/C=C/C1=CC=CO1 |
Computed by PubChem (NCBI)