CAS 158930-18-8 is the registry number for ent-Frovatriptan, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
(6S)-6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (CAS 158930-18-8) is a chemical compound with the molecular formula C14H17N3O and a molecular weight of 243.30 g/mol. IUPAC name: (6S)-6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide. InChIKey: XPSQPHWEGNHMSK-VIFPVBQESA-N.
| Molecular formula | C14H17N3O |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (6S)-6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| InChIKey | XPSQPHWEGNHMSK-VIFPVBQESA-N |
| SMILES | CN[C@H]1CCC2=C(C1)C3=C(N2)C=CC(=C3)C(=O)N |
Computed by PubChem (NCBI)