Products 1589338-26-0
CAS 1589338-26-0 is the registry number for 1-((3-Fluorophenyl)sulfonyl)pyrrolidin-3-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-fluorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride (CAS 1589338-26-0) is a chemical compound with the molecular formula C10H14ClFN2O2S and a molecular weight of 280.75 g/mol. IUPAC name: 1-(3-fluorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride. InChIKey: IFBBZERRDHDENB-UHFFFAOYSA-N.
| Molecular formula | C10H14ClFN2O2S |
|---|---|
| Molecular weight | 280.75 g/mol |
| IUPAC name | 1-(3-fluorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride |
| InChIKey | IFBBZERRDHDENB-UHFFFAOYSA-N |
| SMILES | C1CN(CC1N)S(=O)(=O)C2=CC=CC(=C2)F.Cl |
Computed by PubChem (NCBI)