CAS 1607288-17-4 is the registry number for 2-(4-(Aminomethyl)-2-fluorophenyl)isothiazolidine 1,1-dioxide hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
[4-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-fluorophenyl]methanamine;hydrochloride (CAS 1607288-17-4) is a chemical compound with the molecular formula C10H14ClFN2O2S and a molecular weight of 280.75 g/mol. IUPAC name: [4-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-fluorophenyl]methanamine;hydrochloride. InChIKey: NCJHZZUYQXHSNY-UHFFFAOYSA-N.
| Molecular formula | C10H14ClFN2O2S |
|---|---|
| Molecular weight | 280.75 g/mol |
| IUPAC name | [4-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-fluorophenyl]methanamine;hydrochloride |
| InChIKey | NCJHZZUYQXHSNY-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)C2=C(C=C(C=C2)CN)F.Cl |
Computed by PubChem (NCBI)