CAS 15898-42-7 appears in our catalog under these names: Sodium 4-cyanobenzenesulfinate 95%, Sodium 4-cyanobenzenesulfinate, 95%, 95%, 4-Cyanobenzenesulfinate sodium, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
Sodium 4-cyanobenzenesulfinate (CAS 15898-42-7) is a chemical compound with the molecular formula C7H4NNaO2S and a molecular weight of 189.17 g/mol. IUPAC name: sodium 4-cyanobenzenesulfinate. InChIKey: WNRREQPZEBZGFA-UHFFFAOYSA-M.
| Molecular formula | C7H4NNaO2S |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | sodium 4-cyanobenzenesulfinate |
| InChIKey | WNRREQPZEBZGFA-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1C#N)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)