CAS 1616974-35-6 is the registry number for Sodium 2-cyanobenzene-1-sulfinate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Sodium 2-cyanobenzenesulfinate (CAS 1616974-35-6) is a chemical compound with the molecular formula C7H4NNaO2S and a molecular weight of 189.17 g/mol. IUPAC name: sodium 2-cyanobenzenesulfinate. InChIKey: DZZKXJFLMBXZLL-UHFFFAOYSA-M.
| Molecular formula | C7H4NNaO2S |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | sodium 2-cyanobenzenesulfinate |
| InChIKey | DZZKXJFLMBXZLL-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)C#N)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)