CAS 15905-32-5 appears in our catalog under these names: Erythrosin B, Erythrosine B free acid, 98%, Solvent Red 140, Erythrosin B/ 98.36% (existing batch purity), Tetraiodofluorescein. Offered by: TRC, AmBeed, Dr. Ehrenstorfer, TargetMol, GLPBio. Available pack sizes: 10g, 5g, 500g, 50mg, 1g, 100mg, 200mg, 100g.
3',6'-dihydroxy-2',4',5',7'-tetraiodospiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 15905-32-5) is a chemical compound with the molecular formula C20H8I4O5 and a molecular weight of 835.9 g/mol. IUPAC name: 3',6'-dihydroxy-2',4',5',7'-tetraiodospiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: OALHHIHQOFIMEF-UHFFFAOYSA-N.
| Molecular formula | C20H8I4O5 |
|---|---|
| Molecular weight | 835.9 g/mol |
| IUPAC name | 3',6'-dihydroxy-2',4',5',7'-tetraiodospiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChIKey | OALHHIHQOFIMEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=CC(=C(C(=C4OC5=C(C(=C(C=C35)I)O)I)I)O)I |
Computed by PubChem (NCBI)